C13H23N6O+ — CID 168605345
2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenoxy]ethyl-trimethylazanium (PubChem CID 168605345) has the molecular formula C13H23N6O+ and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenoxy]ethyl-trimethylazanium.
| Compound Name | 2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 168605345 |
| Molecular Formula | C13H23N6O+ |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenoxy]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOc1ccc(/N=C(\N)N=C(N)N)cc1 |
| InChI | InChI=1S/C13H23N6O/c1-19(2,3)8-9-20-11-6-4-10(5-7-11)17-13(16)18-12(14)15/h4-7H,8-9H2,1-3H3,(H6,14,15,16,17,18)/q+1 |
| InChIKey | LRFRNVAWUXPQTM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|