C11H19N5O3Si — CID 168604796
1-(diaminomethylidene)-2-(4-trimethoxysilylphenyl)guanidine (PubChem CID 168604796) has the molecular formula C11H19N5O3Si and a molecular weight of 297.39 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(4-trimethoxysilylphenyl)guanidine.
| Compound Name | 1-(diaminomethylidene)-2-(4-trimethoxysilylphenyl)guanidine |
|---|---|
| PubChem CID | 168604796 |
| Molecular Formula | C11H19N5O3Si |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-(diaminomethylidene)-2-(4-trimethoxysilylphenyl)guanidine |
| SMILES | CO[Si](OC)(OC)c1ccc(/N=C(\N)N=C(N)N)cc1 |
| InChI | InChI=1S/C11H19N5O3Si/c1-17-20(18-2,19-3)9-6-4-8(5-7-9)15-11(14)16-10(12)13/h4-7H,1-3H3,(H6,12,13,14,15,16) |
| InChIKey | GVOPZMWCQCILSX-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|