C19H22N6O4 — CID 168605054
dimethyl 4-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2,6-dimethylpyridine-3,5-dicarboxylate (PubChem CID 168605054) has the molecular formula C19H22N6O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is dimethyl 4-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2,6-dimethylpyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2,6-dimethylpyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 168605054 |
| Molecular Formula | C19H22N6O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | dimethyl 4-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2,6-dimethylpyridine-3,5-dicarboxylate |
| SMILES | COC(=O)c1c(C)nc(C)c(C(=O)OC)c1-c1ccc(/N=C(\N)N=C(N)N)cc1 |
| InChI | InChI=1S/C19H22N6O4/c1-9-13(16(26)28-3)15(14(10(2)23-9)17(27)29-4)11-5-7-12(8-6-11)24-19(22)25-18(20)21/h5-8H,1-4H3,(H6,20,21,22,24,25) |
| InChIKey | SDBVAQMNIKOUHJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 168.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|