C16H16FN5O2 — CID 168605167
methyl 4-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-fluorobenzoate (PubChem CID 168605167) has the molecular formula C16H16FN5O2 and a molecular weight of 329.34 g/mol. Its IUPAC name is methyl 4-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-fluorobenzoate.
| Compound Name | methyl 4-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 168605167 |
| Molecular Formula | C16H16FN5O2 |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | methyl 4-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(/N=C(\N)N=C(N)N)cc2)cc1F |
| InChI | InChI=1S/C16H16FN5O2/c1-24-14(23)12-7-4-10(8-13(12)17)9-2-5-11(6-3-9)21-16(20)22-15(18)19/h2-8H,1H3,(H6,18,19,20,21,22) |
| InChIKey | CBVANONRJFFJKZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|