C10H13FN6O — CID 168602665
N-[4-[[amino-(diaminomethylideneamino)methylidene]amino]-2-fluorophenyl]acetamide (PubChem CID 168602665) has the molecular formula C10H13FN6O and a molecular weight of 252.25 g/mol. Its IUPAC name is N-[4-[[amino-(diaminomethylideneamino)methylidene]amino]-2-fluorophenyl]acetamide.
| Compound Name | N-[4-[[amino-(diaminomethylideneamino)methylidene]amino]-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 168602665 |
| Molecular Formula | C10H13FN6O |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[4-[[amino-(diaminomethylideneamino)methylidene]amino]-2-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/N=C(\N)N=C(N)N)cc1F |
| InChI | InChI=1S/C10H13FN6O/c1-5(18)15-8-3-2-6(4-7(8)11)16-10(14)17-9(12)13/h2-4H,1H3,(H,15,18)(H6,12,13,14,16,17) |
| InChIKey | NGUYAVYMFFBIKS-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|