C8H9ClF2IN5 — CID 146317018
1-(diaminomethylidene)-2-(3,5-difluoro-4-iodophenyl)guanidine;hydrochloride (PubChem CID 146317018) has the molecular formula C8H9ClF2IN5 and a molecular weight of 375.55 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(3,5-difluoro-4-iodophenyl)guanidine;hydrochloride.
| Compound Name | 1-(diaminomethylidene)-2-(3,5-difluoro-4-iodophenyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 146317018 |
| Molecular Formula | C8H9ClF2IN5 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 1-(diaminomethylidene)-2-(3,5-difluoro-4-iodophenyl)guanidine;hydrochloride |
| SMILES | Cl.NC(N)=N/C(N)=N/c1cc(F)c(I)c(F)c1 |
| InChI | InChI=1S/C8H8F2IN5.ClH/c9-4-1-3(2-5(10)6(4)11)15-8(14)16-7(12)13;/h1-2H,(H6,12,13,14,15,16);1H |
| InChIKey | GTPYJMBCXFUZQD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|