C8H7BrF3N5 — CID 168605685
2-(2-bromo-3,4,6-trifluorophenyl)-1-(diaminomethylidene)guanidine (PubChem CID 168605685) has the molecular formula C8H7BrF3N5 and a molecular weight of 310.08 g/mol. Its IUPAC name is 2-(2-bromo-3,4,6-trifluorophenyl)-1-(diaminomethylidene)guanidine.
| Compound Name | 2-(2-bromo-3,4,6-trifluorophenyl)-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168605685 |
| Molecular Formula | C8H7BrF3N5 |
| Molecular Weight | 310.08 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 2-(2-bromo-3,4,6-trifluorophenyl)-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N\c1c(F)cc(F)c(F)c1Br |
| InChI | InChI=1S/C8H7BrF3N5/c9-4-5(12)2(10)1-3(11)6(4)16-8(15)17-7(13)14/h1H,(H6,13,14,15,16,17) |
| InChIKey | NQHSENMSPGWIQB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.08 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|