C10H13Br2N5 — CID 168601891
1-(diaminomethylidene)-2-(2,6-dibromo-4-ethylphenyl)guanidine (PubChem CID 168601891) has the molecular formula C10H13Br2N5 and a molecular weight of 363.06 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(2,6-dibromo-4-ethylphenyl)guanidine.
| Compound Name | 1-(diaminomethylidene)-2-(2,6-dibromo-4-ethylphenyl)guanidine |
|---|---|
| PubChem CID | 168601891 |
| Molecular Formula | C10H13Br2N5 |
| Molecular Weight | 363.06 g/mol |
| Exact Mass | 360.95 |
| IUPAC Name | 1-(diaminomethylidene)-2-(2,6-dibromo-4-ethylphenyl)guanidine |
| SMILES | CCc1cc(Br)c(/N=C(/N)N=C(N)N)c(Br)c1 |
| InChI | InChI=1S/C10H13Br2N5/c1-2-5-3-6(11)8(7(12)4-5)16-10(15)17-9(13)14/h3-4H,2H2,1H3,(H6,13,14,15,16,17) |
| InChIKey | PMECXHRHAHKKRU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.06 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|