C10H11Br2N5O2 — CID 168605427
2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]-3,5-dibromophenyl]acetic acid (PubChem CID 168605427) has the molecular formula C10H11Br2N5O2 and a molecular weight of 393.04 g/mol. Its IUPAC name is 2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]-3,5-dibromophenyl]acetic acid.
| Compound Name | 2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]-3,5-dibromophenyl]acetic acid |
|---|---|
| PubChem CID | 168605427 |
| Molecular Formula | C10H11Br2N5O2 |
| Molecular Weight | 393.04 g/mol |
| Exact Mass | 390.93 |
| IUPAC Name | 2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]-3,5-dibromophenyl]acetic acid |
| SMILES | NC(N)=N/C(N)=N\c1c(Br)cc(CC(=O)O)cc1Br |
| InChI | InChI=1S/C10H11Br2N5O2/c11-5-1-4(3-7(18)19)2-6(12)8(5)16-10(15)17-9(13)14/h1-2H,3H2,(H,18,19)(H6,13,14,15,16,17) |
| InChIKey | WLZOFNRVWTWCRS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.04 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|