C9H11BrN6O2 — CID 168601595
2-(2-bromo-6-methyl-4-nitrophenyl)-1-(diaminomethylidene)guanidine (PubChem CID 168601595) has the molecular formula C9H11BrN6O2 and a molecular weight of 315.13 g/mol. Its IUPAC name is 2-(2-bromo-6-methyl-4-nitrophenyl)-1-(diaminomethylidene)guanidine.
| Compound Name | 2-(2-bromo-6-methyl-4-nitrophenyl)-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168601595 |
| Molecular Formula | C9H11BrN6O2 |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-(2-bromo-6-methyl-4-nitrophenyl)-1-(diaminomethylidene)guanidine |
| SMILES | Cc1cc([N+](=O)[O-])cc(Br)c1/N=C(/N)N=C(N)N |
| InChI | InChI=1S/C9H11BrN6O2/c1-4-2-5(16(17)18)3-6(10)7(4)14-9(13)15-8(11)12/h2-3H,1H3,(H6,11,12,13,14,15) |
| InChIKey | IZOQCQMNMFIJOL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 145.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|