C16H18N6O3 — CID 168603863
1-(diaminomethylidene)-2-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]guanidine (PubChem CID 168603863) has the molecular formula C16H18N6O3 and a molecular weight of 342.36 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]guanidine |
|---|---|
| PubChem CID | 168603863 |
| Molecular Formula | C16H18N6O3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-(diaminomethylidene)-2-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]guanidine |
| SMILES | Cc1ccc(C)c(Oc2cc(/N=C(\N)N=C(N)N)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C16H18N6O3/c1-9-3-4-10(2)14(5-9)25-13-7-11(6-12(8-13)22(23)24)20-16(19)21-15(17)18/h3-8H,1-2H3,(H6,17,18,19,20,21) |
| InChIKey | VTDAXDCXBJFWQG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 155.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|