C15H16N8O3 — CID 168604130
1-(diaminomethylidene)-2-[3-nitro-5-(1-pyridin-3-ylethylideneamino)oxyphenyl]guanidine (PubChem CID 168604130) has the molecular formula C15H16N8O3 and a molecular weight of 356.35 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[3-nitro-5-(1-pyridin-3-ylethylideneamino)oxyphenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[3-nitro-5-(1-pyridin-3-ylethylideneamino)oxyphenyl]guanidine |
|---|---|
| PubChem CID | 168604130 |
| Molecular Formula | C15H16N8O3 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-(diaminomethylidene)-2-[3-nitro-5-(1-pyridin-3-ylethylideneamino)oxyphenyl]guanidine |
| SMILES | CC(=NOc1cc(/N=C(\N)N=C(N)N)cc([N+](=O)[O-])c1)c1cccnc1 |
| InChI | InChI=1S/C15H16N8O3/c1-9(10-3-2-4-19-8-10)22-26-13-6-11(5-12(7-13)23(24)25)20-15(18)21-14(16)17/h2-8H,1H3,(H6,16,17,18,20,21) |
| InChIKey | JAEKIPACLZOQLT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 180.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|