C15H16N6O4 — CID 168603764
1-(diaminomethylidene)-2-[3-(2-methoxyphenoxy)-5-nitrophenyl]guanidine (PubChem CID 168603764) has the molecular formula C15H16N6O4 and a molecular weight of 344.33 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[3-(2-methoxyphenoxy)-5-nitrophenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[3-(2-methoxyphenoxy)-5-nitrophenyl]guanidine |
|---|---|
| PubChem CID | 168603764 |
| Molecular Formula | C15H16N6O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-(diaminomethylidene)-2-[3-(2-methoxyphenoxy)-5-nitrophenyl]guanidine |
| SMILES | COc1ccccc1Oc1cc(/N=C(\N)N=C(N)N)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H16N6O4/c1-24-12-4-2-3-5-13(12)25-11-7-9(6-10(8-11)21(22)23)19-15(18)20-14(16)17/h2-8H,1H3,(H6,16,17,18,19,20) |
| InChIKey | YDAYTKACFBPESB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 164.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|