C10H14N6O3 — CID 168602780
1-(diaminomethylidene)-2-(5-methoxy-2-methyl-4-nitrophenyl)guanidine (PubChem CID 168602780) has the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(5-methoxy-2-methyl-4-nitrophenyl)guanidine.
| Compound Name | 1-(diaminomethylidene)-2-(5-methoxy-2-methyl-4-nitrophenyl)guanidine |
|---|---|
| PubChem CID | 168602780 |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-(diaminomethylidene)-2-(5-methoxy-2-methyl-4-nitrophenyl)guanidine |
| SMILES | COc1cc(/N=C(\N)N=C(N)N)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N6O3/c1-5-3-7(16(17)18)8(19-2)4-6(5)14-10(13)15-9(11)12/h3-4H,1-2H3,(H6,11,12,13,14,15) |
| InChIKey | UGRCJAGHBWRGOG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 155.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|