C10H14BrN5O — CID 168603340
2-(5-bromo-3-methoxy-2-methylphenyl)-1-(diaminomethylidene)guanidine (PubChem CID 168603340) has the molecular formula C10H14BrN5O and a molecular weight of 300.16 g/mol. Its IUPAC name is 2-(5-bromo-3-methoxy-2-methylphenyl)-1-(diaminomethylidene)guanidine.
| Compound Name | 2-(5-bromo-3-methoxy-2-methylphenyl)-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168603340 |
| Molecular Formula | C10H14BrN5O |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2-(5-bromo-3-methoxy-2-methylphenyl)-1-(diaminomethylidene)guanidine |
| SMILES | COc1cc(Br)cc(/N=C(\N)N=C(N)N)c1C |
| InChI | InChI=1S/C10H14BrN5O/c1-5-7(15-10(14)16-9(12)13)3-6(11)4-8(5)17-2/h3-4H,1-2H3,(H6,12,13,14,15,16) |
| InChIKey | IHNQBELORDBPTB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|