C11H15N5O4 — CID 168604107
methyl 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-hydroxy-5-methoxybenzoate (PubChem CID 168604107) has the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. Its IUPAC name is methyl 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-hydroxy-5-methoxybenzoate.
| Compound Name | methyl 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-hydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 168604107 |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | methyl 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-hydroxy-5-methoxybenzoate |
| SMILES | COC(=O)c1cc(/N=C(\N)N=C(N)N)c(O)c(OC)c1 |
| InChI | InChI=1S/C11H15N5O4/c1-19-7-4-5(9(18)20-2)3-6(8(7)17)15-11(14)16-10(12)13/h3-4,17H,1-2H3,(H6,12,13,14,15,16) |
| InChIKey | KAJQERVUOMNJCW-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 158.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|