C10H15N5O2S — CID 168604047
1-(diaminomethylidene)-2-(4,5-dimethoxy-2-sulfanylphenyl)guanidine (PubChem CID 168604047) has the molecular formula C10H15N5O2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(4,5-dimethoxy-2-sulfanylphenyl)guanidine.
| Compound Name | 1-(diaminomethylidene)-2-(4,5-dimethoxy-2-sulfanylphenyl)guanidine |
|---|---|
| PubChem CID | 168604047 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-(diaminomethylidene)-2-(4,5-dimethoxy-2-sulfanylphenyl)guanidine |
| SMILES | COc1cc(S)c(/N=C(\N)N=C(N)N)cc1OC |
| InChI | InChI=1S/C10H15N5O2S/c1-16-6-3-5(8(18)4-7(6)17-2)14-10(13)15-9(11)12/h3-4,18H,1-2H3,(H6,11,12,13,14,15) |
| InChIKey | KXGMXPCRSIKFSN-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|