C12H17N5O4 — CID 168603554
methyl 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4,5-dimethoxybenzoate (PubChem CID 168603554) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is methyl 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 168603554 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | methyl 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(/N=C(\N)N=C(N)N)c(OC)c(OC)c1 |
| InChI | InChI=1S/C12H17N5O4/c1-19-8-5-6(10(18)21-3)4-7(9(8)20-2)16-12(15)17-11(13)14/h4-5H,1-3H3,(H6,13,14,15,16,17) |
| InChIKey | SRTQNTBOASGHFO-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|