C11H14FN5O2 — CID 168605132
methyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-4-fluoro-5-methylbenzoate (PubChem CID 168605132) has the molecular formula C11H14FN5O2 and a molecular weight of 267.26 g/mol. Its IUPAC name is methyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-4-fluoro-5-methylbenzoate.
| Compound Name | methyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-4-fluoro-5-methylbenzoate |
|---|---|
| PubChem CID | 168605132 |
| Molecular Formula | C11H14FN5O2 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | methyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-4-fluoro-5-methylbenzoate |
| SMILES | COC(=O)c1cc(C)c(F)cc1/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C11H14FN5O2/c1-5-3-6(9(18)19-2)8(4-7(5)12)16-11(15)17-10(13)14/h3-4H,1-2H3,(H6,13,14,15,16,17) |
| InChIKey | MCXAFHMXKYDHRZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|