C11H14BrN5O3 — CID 168605577
methyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-3-bromo-5-methoxybenzoate (PubChem CID 168605577) has the molecular formula C11H14BrN5O3 and a molecular weight of 344.17 g/mol. Its IUPAC name is methyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-3-bromo-5-methoxybenzoate.
| Compound Name | methyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-3-bromo-5-methoxybenzoate |
|---|---|
| PubChem CID | 168605577 |
| Molecular Formula | C11H14BrN5O3 |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | methyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-3-bromo-5-methoxybenzoate |
| SMILES | COC(=O)c1cc(OC)cc(Br)c1/N=C(/N)N=C(N)N |
| InChI | InChI=1S/C11H14BrN5O3/c1-19-5-3-6(9(18)20-2)8(7(12)4-5)16-11(15)17-10(13)14/h3-4H,1-2H3,(H6,13,14,15,16,17) |
| InChIKey | UPSXZYBCTHIJMA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|