C17H18BrN5O3 — CID 168603490
methyl 4-[[amino-(diaminomethylideneamino)methylidene]amino]-3-bromo-5-phenylmethoxybenzoate (PubChem CID 168603490) has the molecular formula C17H18BrN5O3 and a molecular weight of 420.27 g/mol. Its IUPAC name is methyl 4-[[amino-(diaminomethylideneamino)methylidene]amino]-3-bromo-5-phenylmethoxybenzoate.
| Compound Name | methyl 4-[[amino-(diaminomethylideneamino)methylidene]amino]-3-bromo-5-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 168603490 |
| Molecular Formula | C17H18BrN5O3 |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | methyl 4-[[amino-(diaminomethylideneamino)methylidene]amino]-3-bromo-5-phenylmethoxybenzoate |
| SMILES | COC(=O)c1cc(Br)c(/N=C(/N)N=C(N)N)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C17H18BrN5O3/c1-25-15(24)11-7-12(18)14(22-17(21)23-16(19)20)13(8-11)26-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H6,19,20,21,22,23) |
| InChIKey | IPZZWSAKBXXSOY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|