C9H12BrN5O2 — CID 168605908
2-(3-bromo-2-hydroxy-5-methoxyphenyl)-1-(diaminomethylidene)guanidine (PubChem CID 168605908) has the molecular formula C9H12BrN5O2 and a molecular weight of 302.13 g/mol. Its IUPAC name is 2-(3-bromo-2-hydroxy-5-methoxyphenyl)-1-(diaminomethylidene)guanidine.
| Compound Name | 2-(3-bromo-2-hydroxy-5-methoxyphenyl)-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168605908 |
| Molecular Formula | C9H12BrN5O2 |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2-(3-bromo-2-hydroxy-5-methoxyphenyl)-1-(diaminomethylidene)guanidine |
| SMILES | COc1cc(Br)c(O)c(/N=C(\N)N=C(N)N)c1 |
| InChI | InChI=1S/C9H12BrN5O2/c1-17-4-2-5(10)7(16)6(3-4)14-9(13)15-8(11)12/h2-3,16H,1H3,(H6,11,12,13,14,15) |
| InChIKey | QXXWEYOZVQPGOR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|