C10H12BrN5O2 — CID 168602496
5-[[amino-(diaminomethylideneamino)methylidene]amino]-2-bromo-4-methylbenzoic acid (PubChem CID 168602496) has the molecular formula C10H12BrN5O2 and a molecular weight of 314.14 g/mol. Its IUPAC name is 5-[[amino-(diaminomethylideneamino)methylidene]amino]-2-bromo-4-methylbenzoic acid.
| Compound Name | 5-[[amino-(diaminomethylideneamino)methylidene]amino]-2-bromo-4-methylbenzoic acid |
|---|---|
| PubChem CID | 168602496 |
| Molecular Formula | C10H12BrN5O2 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 5-[[amino-(diaminomethylideneamino)methylidene]amino]-2-bromo-4-methylbenzoic acid |
| SMILES | Cc1cc(Br)c(C(=O)O)cc1/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C10H12BrN5O2/c1-4-2-6(11)5(8(17)18)3-7(4)15-10(14)16-9(12)13/h2-3H,1H3,(H,17,18)(H6,12,13,14,15,16) |
| InChIKey | VSYYMSCMIMFBMU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|