C11H14ClN5O3 — CID 168605912
4-[[amino-(diaminomethylideneamino)methylidene]amino]-5-chloro-2-ethoxybenzoic acid (PubChem CID 168605912) has the molecular formula C11H14ClN5O3 and a molecular weight of 299.72 g/mol. Its IUPAC name is 4-[[amino-(diaminomethylideneamino)methylidene]amino]-5-chloro-2-ethoxybenzoic acid.
| Compound Name | 4-[[amino-(diaminomethylideneamino)methylidene]amino]-5-chloro-2-ethoxybenzoic acid |
|---|---|
| PubChem CID | 168605912 |
| Molecular Formula | C11H14ClN5O3 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-[[amino-(diaminomethylideneamino)methylidene]amino]-5-chloro-2-ethoxybenzoic acid |
| SMILES | CCOc1cc(/N=C(\N)N=C(N)N)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C11H14ClN5O3/c1-2-20-8-4-7(16-11(15)17-10(13)14)6(12)3-5(8)9(18)19/h3-4H,2H2,1H3,(H,18,19)(H6,13,14,15,16,17) |
| InChIKey | HNRUFRWKUNOXBF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|