C12H17N5O3S — CID 168605903
4-[[amino-(diaminomethylideneamino)methylidene]amino]-5-ethylsulfanyl-2-methoxybenzoic acid (PubChem CID 168605903) has the molecular formula C12H17N5O3S and a molecular weight of 311.37 g/mol. Its IUPAC name is 4-[[amino-(diaminomethylideneamino)methylidene]amino]-5-ethylsulfanyl-2-methoxybenzoic acid.
| Compound Name | 4-[[amino-(diaminomethylideneamino)methylidene]amino]-5-ethylsulfanyl-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 168605903 |
| Molecular Formula | C12H17N5O3S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 4-[[amino-(diaminomethylideneamino)methylidene]amino]-5-ethylsulfanyl-2-methoxybenzoic acid |
| SMILES | CCSc1cc(C(=O)O)c(OC)cc1/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C12H17N5O3S/c1-3-21-9-4-6(10(18)19)8(20-2)5-7(9)16-12(15)17-11(13)14/h4-5H,3H2,1-2H3,(H,18,19)(H6,13,14,15,16,17) |
| InChIKey | UCPILOVAJACLNH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|