C17H19NO5S2 — CID 169373387
5-ethylsulfanyl-2-methoxy-4-[(4-methylphenyl)sulfonylamino]benzoic acid (PubChem CID 169373387) has the molecular formula C17H19NO5S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 5-ethylsulfanyl-2-methoxy-4-[(4-methylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 5-ethylsulfanyl-2-methoxy-4-[(4-methylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 169373387 |
| Molecular Formula | C17H19NO5S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 5-ethylsulfanyl-2-methoxy-4-[(4-methylphenyl)sulfonylamino]benzoic acid |
| SMILES | CCSc1cc(C(=O)O)c(OC)cc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H19NO5S2/c1-4-24-16-9-13(17(19)20)15(23-3)10-14(16)18-25(21,22)12-7-5-11(2)6-8-12/h5-10,18H,4H2,1-3H3,(H,19,20) |
| InChIKey | SDDAZUNQEUZSLB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |