C10H13ClFN5O — CID 168602849
2-(4-chloro-3-ethoxy-2-fluorophenyl)-1-(diaminomethylidene)guanidine (PubChem CID 168602849) has the molecular formula C10H13ClFN5O and a molecular weight of 273.70 g/mol. Its IUPAC name is 2-(4-chloro-3-ethoxy-2-fluorophenyl)-1-(diaminomethylidene)guanidine.
| Compound Name | 2-(4-chloro-3-ethoxy-2-fluorophenyl)-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168602849 |
| Molecular Formula | C10H13ClFN5O |
| Molecular Weight | 273.70 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-(4-chloro-3-ethoxy-2-fluorophenyl)-1-(diaminomethylidene)guanidine |
| SMILES | CCOc1c(Cl)ccc(/N=C(\N)N=C(N)N)c1F |
| InChI | InChI=1S/C10H13ClFN5O/c1-2-18-8-5(11)3-4-6(7(8)12)16-10(15)17-9(13)14/h3-4H,2H2,1H3,(H6,13,14,15,16,17) |
| InChIKey | RRSQQAZKDQPDME-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.70 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|