C16H27ClN6O2S — CID 168604578
2-[2-chloro-5-(dibutylsulfamoyl)phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168604578) has the molecular formula C16H27ClN6O2S and a molecular weight of 402.95 g/mol. Its IUPAC name is 2-[2-chloro-5-(dibutylsulfamoyl)phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[2-chloro-5-(dibutylsulfamoyl)phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168604578 |
| Molecular Formula | C16H27ClN6O2S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-[2-chloro-5-(dibutylsulfamoyl)phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(Cl)c(/N=C(\N)N=C(N)N)c1 |
| InChI | InChI=1S/C16H27ClN6O2S/c1-3-5-9-23(10-6-4-2)26(24,25)12-7-8-13(17)14(11-12)21-16(20)22-15(18)19/h7-8,11H,3-6,9-10H2,1-2H3,(H6,18,19,20,21,22) |
| InChIKey | LPFMZWUTPKEEMV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|