C14H21ClN4O2S — CID 150333076
3-azido-N,N-dibutyl-4-chlorobenzenesulfonamide (PubChem CID 150333076) has the molecular formula C14H21ClN4O2S and a molecular weight of 344.87 g/mol. Its IUPAC name is 3-azido-N,N-dibutyl-4-chlorobenzenesulfonamide.
| Compound Name | 3-azido-N,N-dibutyl-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 150333076 |
| Molecular Formula | C14H21ClN4O2S |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 3-azido-N,N-dibutyl-4-chlorobenzenesulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(Cl)c(N=[N+]=[N-])c1 |
| InChI | InChI=1S/C14H21ClN4O2S/c1-3-5-9-19(10-6-4-2)22(20,21)12-7-8-13(15)14(11-12)17-18-16/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | GQCAWUQGIFAVLQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|