About CID 174673959
CID 174673959 (PubChem CID 174673959) has the molecular formula C8H7ClFOSn
and a molecular weight of 292.30 g/mol.
Molecular Properties
| Compound Name | CID 174673959 |
| PubChem CID | 174673959 |
| Molecular Formula | C8H7ClFOSn |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.92 |
| IUPAC Name | — |
| SMILES | CCOc1c(Cl)ccc([Sn])c1F |
| InChI | InChI=1S/C8H7ClFO.Sn/c1-2-11-8-6(9)4-3-5-7(8)10;/h3-4H,2H2,1H3; |
| InChIKey | NEZUYHPKDCFDME-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 174673959 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174673959?
The IUPAC name of CID 174673959 (CID 174673959) is not available.
What is the SMILES notation for CID 174673959?
The canonical SMILES for CID 174673959 is CCOc1c(Cl)ccc([Sn])c1F.
What is the InChIKey of CID 174673959?
The InChIKey is NEZUYHPKDCFDME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClFO.Sn/c1-2-11-8-6(9)4-3-5-7(8)10;/h3-4H,2H2,1H3;.
What are the key properties of CID 174673959?
CID 174673959 has a molecular weight of 292.30 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174673959 is sourced from PubChem (CID 174673959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).