C17H11ClF2O3S — CID 168780839
3-(4-chloro-3-ethoxy-2-fluorophenyl)-6-fluoro-1-benzothiophene-2-carboxylic acid (PubChem CID 168780839) has the molecular formula C17H11ClF2O3S and a molecular weight of 368.79 g/mol. Its IUPAC name is 3-(4-chloro-3-ethoxy-2-fluorophenyl)-6-fluoro-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-(4-chloro-3-ethoxy-2-fluorophenyl)-6-fluoro-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 168780839 |
| Molecular Formula | C17H11ClF2O3S |
| Molecular Weight | 368.79 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 3-(4-chloro-3-ethoxy-2-fluorophenyl)-6-fluoro-1-benzothiophene-2-carboxylic acid |
| SMILES | CCOc1c(Cl)ccc(-c2c(C(=O)O)sc3cc(F)ccc23)c1F |
| InChI | InChI=1S/C17H11ClF2O3S/c1-2-23-15-11(18)6-5-10(14(15)20)13-9-4-3-8(19)7-12(9)24-16(13)17(21)22/h3-7H,2H2,1H3,(H,21,22) |
| InChIKey | WWNLSLHJVKSWRF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.79 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |