C15H5F5O2S — CID 168780834
6-fluoro-3-(2,3,5,6-tetrafluorophenyl)-1-benzothiophene-2-carboxylic acid (PubChem CID 168780834) has the molecular formula C15H5F5O2S and a molecular weight of 344.26 g/mol. Its IUPAC name is 6-fluoro-3-(2,3,5,6-tetrafluorophenyl)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 6-fluoro-3-(2,3,5,6-tetrafluorophenyl)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 168780834 |
| Molecular Formula | C15H5F5O2S |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 6-fluoro-3-(2,3,5,6-tetrafluorophenyl)-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc2cc(F)ccc2c1-c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C15H5F5O2S/c16-5-1-2-6-9(3-5)23-14(15(21)22)10(6)11-12(19)7(17)4-8(18)13(11)20/h1-4H,(H,21,22) |
| InChIKey | PDOXGPRHKMCYFP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|