C15H9ClF3NO2S — CID 168781028
azanium 3-(2-chloro-3,5-difluorophenyl)-6-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 168781028) has the molecular formula C15H9ClF3NO2S and a molecular weight of 359.76 g/mol. Its IUPAC name is azanium 3-(2-chloro-3,5-difluorophenyl)-6-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | azanium 3-(2-chloro-3,5-difluorophenyl)-6-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 168781028 |
| Molecular Formula | C15H9ClF3NO2S |
| Molecular Weight | 359.76 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | azanium 3-(2-chloro-3,5-difluorophenyl)-6-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | O=C([O-])c1sc2cc(F)ccc2c1-c1cc(F)cc(F)c1Cl.[NH4+] |
| InChI | InChI=1S/C15H6ClF3O2S.H3N/c16-13-9(3-7(18)4-10(13)19)12-8-2-1-6(17)5-11(8)22-14(12)15(20)21;/h1-5H,(H,20,21);1H3 |
| InChIKey | XOAGANSEDHXEPI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.76 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|