C17H8ClFN2O3S — CID 2444664
4-amino-2-(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)isoindole-1,3-dione (PubChem CID 2444664) has the molecular formula C17H8ClFN2O3S and a molecular weight of 374.78 g/mol. Its IUPAC name is 4-amino-2-(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)isoindole-1,3-dione.
| Compound Name | 4-amino-2-(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 2444664 |
| Molecular Formula | C17H8ClFN2O3S |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 4-amino-2-(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)isoindole-1,3-dione |
| SMILES | Nc1cccc2c1C(=O)N(C(=O)c1sc3cc(F)ccc3c1Cl)C2=O |
| InChI | InChI=1S/C17H8ClFN2O3S/c18-13-8-5-4-7(19)6-11(8)25-14(13)17(24)21-15(22)9-2-1-3-10(20)12(9)16(21)23/h1-6H,20H2 |
| InChIKey | KWKGAUADVDHSTL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|