C15H15ClFNOS — CID 2426410
azepan-1-yl-(3-chloro-6-fluoro-1-benzothiophen-2-yl)methanone (PubChem CID 2426410) has the molecular formula C15H15ClFNOS and a molecular weight of 311.81 g/mol. Its IUPAC name is azepan-1-yl-(3-chloro-6-fluoro-1-benzothiophen-2-yl)methanone.
| Compound Name | azepan-1-yl-(3-chloro-6-fluoro-1-benzothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 2426410 |
| Molecular Formula | C15H15ClFNOS |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | azepan-1-yl-(3-chloro-6-fluoro-1-benzothiophen-2-yl)methanone |
| SMILES | O=C(c1sc2cc(F)ccc2c1Cl)N1CCCCCC1 |
| InChI | InChI=1S/C15H15ClFNOS/c16-13-11-6-5-10(17)9-12(11)20-14(13)15(19)18-7-3-1-2-4-8-18/h5-6,9H,1-4,7-8H2 |
| InChIKey | XDSMHUSPIJLRBD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |