C15H11ClFNO3S — CID 149024942
2-(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)-6-oxa-2-azaspiro[3.4]octan-7-one (PubChem CID 149024942) has the molecular formula C15H11ClFNO3S and a molecular weight of 339.78 g/mol. Its IUPAC name is 2-(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)-6-oxa-2-azaspiro[3.4]octan-7-one.
| Compound Name | 2-(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)-6-oxa-2-azaspiro[3.4]octan-7-one |
|---|---|
| PubChem CID | 149024942 |
| Molecular Formula | C15H11ClFNO3S |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)-6-oxa-2-azaspiro[3.4]octan-7-one |
| SMILES | O=C1CC2(CO1)CN(C(=O)c1sc3cc(F)ccc3c1Cl)C2 |
| InChI | InChI=1S/C15H11ClFNO3S/c16-12-9-2-1-8(17)3-10(9)22-13(12)14(20)18-5-15(6-18)4-11(19)21-7-15/h1-3H,4-7H2 |
| InChIKey | QEFAYRUYOZSIGU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |