C20H18ClFN2OS — CID 25398251
(3-chloro-6-fluoro-1-benzothiophen-2-yl)-[4-(3-methylphenyl)piperazin-1-yl]methanone (PubChem CID 25398251) has the molecular formula C20H18ClFN2OS and a molecular weight of 388.90 g/mol. Its IUPAC name is (3-chloro-6-fluoro-1-benzothiophen-2-yl)-[4-(3-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | (3-chloro-6-fluoro-1-benzothiophen-2-yl)-[4-(3-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 25398251 |
| Molecular Formula | C20H18ClFN2OS |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (3-chloro-6-fluoro-1-benzothiophen-2-yl)-[4-(3-methylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3sc4cc(F)ccc4c3Cl)CC2)c1 |
| InChI | InChI=1S/C20H18ClFN2OS/c1-13-3-2-4-15(11-13)23-7-9-24(10-8-23)20(25)19-18(21)16-6-5-14(22)12-17(16)26-19/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | GUNMMBOKILUWKD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |