C19H18ClN3OS — CID 17250311
(3-chloro-6-methyl-1-benzothiophen-2-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 17250311) has the molecular formula C19H18ClN3OS and a molecular weight of 371.89 g/mol. Its IUPAC name is (3-chloro-6-methyl-1-benzothiophen-2-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (3-chloro-6-methyl-1-benzothiophen-2-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 17250311 |
| Molecular Formula | C19H18ClN3OS |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (3-chloro-6-methyl-1-benzothiophen-2-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc2c(Cl)c(C(=O)N3CCN(c4ccccn4)CC3)sc2c1 |
| InChI | InChI=1S/C19H18ClN3OS/c1-13-5-6-14-15(12-13)25-18(17(14)20)19(24)23-10-8-22(9-11-23)16-4-2-3-7-21-16/h2-7,12H,8-11H2,1H3 |
| InChIKey | KQQLUYASCKKICO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |