C17H20ClNOS — CID 34258379
(6-tert-butyl-3-chloro-1-benzothiophen-2-yl)-pyrrolidin-1-ylmethanone (PubChem CID 34258379) has the molecular formula C17H20ClNOS and a molecular weight of 321.87 g/mol. Its IUPAC name is (6-tert-butyl-3-chloro-1-benzothiophen-2-yl)-pyrrolidin-1-ylmethanone.
| Compound Name | (6-tert-butyl-3-chloro-1-benzothiophen-2-yl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 34258379 |
| Molecular Formula | C17H20ClNOS |
| Molecular Weight | 321.87 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (6-tert-butyl-3-chloro-1-benzothiophen-2-yl)-pyrrolidin-1-ylmethanone |
| SMILES | CC(C)(C)c1ccc2c(Cl)c(C(=O)N3CCCC3)sc2c1 |
| InChI | InChI=1S/C17H20ClNOS/c1-17(2,3)11-6-7-12-13(10-11)21-15(14(12)18)16(20)19-8-4-5-9-19/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | ATNVRRRZGHUBBS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.87 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |