C16H11ClF3NO3S — CID 168780958
azanium 6-chloro-3-(2,4,5-trifluoro-3-methoxyphenyl)-1-benzothiophene-2-carboxylate (PubChem CID 168780958) has the molecular formula C16H11ClF3NO3S and a molecular weight of 389.78 g/mol. Its IUPAC name is azanium 6-chloro-3-(2,4,5-trifluoro-3-methoxyphenyl)-1-benzothiophene-2-carboxylate.
| Compound Name | azanium 6-chloro-3-(2,4,5-trifluoro-3-methoxyphenyl)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 168780958 |
| Molecular Formula | C16H11ClF3NO3S |
| Molecular Weight | 389.78 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | azanium 6-chloro-3-(2,4,5-trifluoro-3-methoxyphenyl)-1-benzothiophene-2-carboxylate |
| SMILES | COc1c(F)c(F)cc(-c2c(C(=O)[O-])sc3cc(Cl)ccc23)c1F.[NH4+] |
| InChI | InChI=1S/C16H8ClF3O3S.H3N/c1-23-14-12(19)8(5-9(18)13(14)20)11-7-3-2-6(17)4-10(7)24-15(11)16(21)22;/h2-5H,1H3,(H,21,22);1H3 |
| InChIKey | OMPDDZRYCRKSRK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.78 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|