C13H14ClNO2S — CID 53014216
6-chloro-3-methoxy-N-propan-2-yl-1-benzothiophene-2-carboxamide (PubChem CID 53014216) has the molecular formula C13H14ClNO2S and a molecular weight of 283.78 g/mol. Its IUPAC name is 6-chloro-3-methoxy-N-propan-2-yl-1-benzothiophene-2-carboxamide.
| Compound Name | 6-chloro-3-methoxy-N-propan-2-yl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 53014216 |
| Molecular Formula | C13H14ClNO2S |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 6-chloro-3-methoxy-N-propan-2-yl-1-benzothiophene-2-carboxamide |
| SMILES | COc1c(C(=O)NC(C)C)sc2cc(Cl)ccc12 |
| InChI | InChI=1S/C13H14ClNO2S/c1-7(2)15-13(16)12-11(17-3)9-5-4-8(14)6-10(9)18-12/h4-7H,1-3H3,(H,15,16) |
| InChIKey | ZMDNXYRGAYLFDL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |