C21H23Cl2NOS — CID 7529838
N-[(1S)-1-(1-adamantyl)ethyl]-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 7529838) has the molecular formula C21H23Cl2NOS and a molecular weight of 408.39 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7529838 |
| Molecular Formula | C21H23Cl2NOS |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1sc2cc(Cl)ccc2c1Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H23Cl2NOS/c1-11(21-8-12-4-13(9-21)6-14(5-12)10-21)24-20(25)19-18(23)16-3-2-15(22)7-17(16)26-19/h2-3,7,11-14H,4-6,8-10H2,1H3,(H,24,25)/t11-,12?,13?,14?,21?/m0/s1 |
| InChIKey | XLAGODFVKWSRES-OWFXSXJRSA-N |
| XLogP | 6.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |