C16H7ClF3O3S- — CID 168781003
6-chloro-3-(2,4,5-trifluoro-3-methoxyphenyl)-1-benzothiophene-2-carboxylate (PubChem CID 168781003) has the molecular formula C16H7ClF3O3S- and a molecular weight of 371.74 g/mol. Its IUPAC name is 6-chloro-3-(2,4,5-trifluoro-3-methoxyphenyl)-1-benzothiophene-2-carboxylate.
| Compound Name | 6-chloro-3-(2,4,5-trifluoro-3-methoxyphenyl)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 168781003 |
| Molecular Formula | C16H7ClF3O3S- |
| Molecular Weight | 371.74 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 6-chloro-3-(2,4,5-trifluoro-3-methoxyphenyl)-1-benzothiophene-2-carboxylate |
| SMILES | COc1c(F)c(F)cc(-c2c(C(=O)[O-])sc3cc(Cl)ccc23)c1F |
| InChI | InChI=1S/C16H8ClF3O3S/c1-23-14-12(19)8(5-9(18)13(14)20)11-7-3-2-6(17)4-10(7)24-15(11)16(21)22/h2-5H,1H3,(H,21,22)/p-1 |
| InChIKey | MKEYVRVUEMRVKZ-UHFFFAOYSA-M |
| XLogP | 4.01 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.74 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|