About azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate
azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate (PubChem CID 168781015) has the molecular formula C19H18FNO3S
and a molecular weight of 359.42 g/mol. Its IUPAC name is azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate |
| PubChem CID | 168781015 |
| Molecular Formula | C19H18FNO3S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate |
| SMILES | CC1CCOc2ccc(-c3c(C(=O)[O-])sc4cc(F)ccc34)cc21.[NH4+] |
| InChI | InChI=1S/C19H15FO3S.H3N/c1-10-6-7-23-15-5-2-11(8-14(10)15)17-13-4-3-12(20)9-16(13)24-18(17)19(21)22;/h2-5,8-10H,6-7H2,1H3,(H,21,22);1H3 |
| InChIKey | WRKFTHDCLYDAAB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate?
The IUPAC name of azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate (CID 168781015) is azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate.
What is the SMILES notation for azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate?
The canonical SMILES for azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate is CC1CCOc2ccc(-c3c(C(=O)[O-])sc4cc(F)ccc34)cc21.[NH4+].
What is the InChIKey of azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate?
The InChIKey is WRKFTHDCLYDAAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FO3S.H3N/c1-10-6-7-23-15-5-2-11(8-14(10)15)17-13-4-3-12(20)9-16(13)24-18(17)19(21)22;/h2-5,8-10H,6-7H2,1H3,(H,21,22);1H3.
What are the key properties of azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate?
azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate has a molecular weight of 359.42 g/mol, XLogP of 4.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 6-fluoro-3-(4-methyl-3,4-dihydro-2H-chromen-6-yl)-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 168781015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).