C21H18F2O2S — CID 168911536
cyclobutylidene-[3-(5-ethoxy-2-fluorophenyl)-6-fluoro-1-benzothiophen-2-yl]methanol (PubChem CID 168911536) has the molecular formula C21H18F2O2S and a molecular weight of 372.44 g/mol. Its IUPAC name is cyclobutylidene-[3-(5-ethoxy-2-fluorophenyl)-6-fluoro-1-benzothiophen-2-yl]methanol.
| Compound Name | cyclobutylidene-[3-(5-ethoxy-2-fluorophenyl)-6-fluoro-1-benzothiophen-2-yl]methanol |
|---|---|
| PubChem CID | 168911536 |
| Molecular Formula | C21H18F2O2S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | cyclobutylidene-[3-(5-ethoxy-2-fluorophenyl)-6-fluoro-1-benzothiophen-2-yl]methanol |
| SMILES | CCOc1ccc(F)c(-c2c(C(O)=C3CCC3)sc3cc(F)ccc23)c1 |
| InChI | InChI=1S/C21H18F2O2S/c1-2-25-14-7-9-17(23)16(11-14)19-15-8-6-13(22)10-18(15)26-21(19)20(24)12-4-3-5-12/h6-11,24H,2-5H2,1H3 |
| InChIKey | SWOBRGJBMQWLRA-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|