C19H14F2O2S — CID 177019853
(E)-1-[6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophen-2-yl]ethene-1,2-diol (PubChem CID 177019853) has the molecular formula C19H14F2O2S and a molecular weight of 344.38 g/mol. Its IUPAC name is (E)-1-[6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophen-2-yl]ethene-1,2-diol.
| Compound Name | (E)-1-[6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophen-2-yl]ethene-1,2-diol |
|---|---|
| PubChem CID | 177019853 |
| Molecular Formula | C19H14F2O2S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | (E)-1-[6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophen-2-yl]ethene-1,2-diol |
| SMILES | O/C=C(/O)c1sc2cc(F)ccc2c1-c1ccc(F)c2c1CCC2 |
| InChI | InChI=1S/C19H14F2O2S/c20-10-4-5-14-17(8-10)24-19(16(23)9-22)18(14)13-6-7-15(21)12-3-1-2-11(12)13/h4-9,22-23H,1-3H2/b16-9+ |
| InChIKey | PNZFZIUZBWQDJS-CXUHLZMHSA-N |
| XLogP | 5.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|