C10H8F2OS — CID 130870288
2-ethoxy-3,6-difluoro-1-benzothiophene (PubChem CID 130870288) has the molecular formula C10H8F2OS and a molecular weight of 214.24 g/mol. Its IUPAC name is 2-ethoxy-3,6-difluoro-1-benzothiophene.
| Compound Name | 2-ethoxy-3,6-difluoro-1-benzothiophene |
|---|---|
| PubChem CID | 130870288 |
| Molecular Formula | C10H8F2OS |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 2-ethoxy-3,6-difluoro-1-benzothiophene |
| SMILES | CCOc1sc2cc(F)ccc2c1F |
| InChI | InChI=1S/C10H8F2OS/c1-2-13-10-9(12)7-4-3-6(11)5-8(7)14-10/h3-5H,2H2,1H3 |
| InChIKey | IGUOKIMVGHQDRX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |