About 2-ethoxy-3-fluoro-1,4-diiodobenzene
2-ethoxy-3-fluoro-1,4-diiodobenzene (PubChem CID 118852860) has the molecular formula C8H7FI2O
and a molecular weight of 391.95 g/mol. Its IUPAC name is 2-ethoxy-3-fluoro-1,4-diiodobenzene.
Molecular Properties
| Compound Name | 2-ethoxy-3-fluoro-1,4-diiodobenzene |
| PubChem CID | 118852860 |
| Molecular Formula | C8H7FI2O |
| Molecular Weight | 391.95 g/mol |
| Exact Mass | 391.86 |
| IUPAC Name | 2-ethoxy-3-fluoro-1,4-diiodobenzene |
| SMILES | CCOc1c(I)ccc(I)c1F |
| InChI | InChI=1S/C8H7FI2O/c1-2-12-8-6(11)4-3-5(10)7(8)9/h3-4H,2H2,1H3 |
| InChIKey | WTDOMKXMNPYULF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.95 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-3-fluoro-1,4-diiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3-fluoro-1,4-diiodobenzene?
The IUPAC name of 2-ethoxy-3-fluoro-1,4-diiodobenzene (CID 118852860) is 2-ethoxy-3-fluoro-1,4-diiodobenzene.
What is the SMILES notation for 2-ethoxy-3-fluoro-1,4-diiodobenzene?
The canonical SMILES for 2-ethoxy-3-fluoro-1,4-diiodobenzene is CCOc1c(I)ccc(I)c1F.
What is the InChIKey of 2-ethoxy-3-fluoro-1,4-diiodobenzene?
The InChIKey is WTDOMKXMNPYULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FI2O/c1-2-12-8-6(11)4-3-5(10)7(8)9/h3-4H,2H2,1H3.
What are the key properties of 2-ethoxy-3-fluoro-1,4-diiodobenzene?
2-ethoxy-3-fluoro-1,4-diiodobenzene has a molecular weight of 391.95 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-fluoro-1,4-diiodobenzene is sourced from PubChem (CID 118852860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).