C8H8I2O2 — CID 118990980
3-ethoxy-2,4-diiodophenol (PubChem CID 118990980) has the molecular formula C8H8I2O2 and a molecular weight of 389.96 g/mol. Its IUPAC name is 3-ethoxy-2,4-diiodophenol.
| Compound Name | 3-ethoxy-2,4-diiodophenol |
|---|---|
| PubChem CID | 118990980 |
| Molecular Formula | C8H8I2O2 |
| Molecular Weight | 389.96 g/mol |
| Exact Mass | 389.86 |
| IUPAC Name | 3-ethoxy-2,4-diiodophenol |
| SMILES | CCOc1c(I)ccc(O)c1I |
| InChI | InChI=1S/C8H8I2O2/c1-2-12-8-5(9)3-4-6(11)7(8)10/h3-4,11H,2H2,1H3 |
| InChIKey | BPCUYNQEYKCGTQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.96 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|