About 3-ethoxy-1-iodo-2,4-dimethoxybenzene
3-ethoxy-1-iodo-2,4-dimethoxybenzene (PubChem CID 118835970) has the molecular formula C10H13IO3
and a molecular weight of 308.12 g/mol. Its IUPAC name is 3-ethoxy-1-iodo-2,4-dimethoxybenzene.
Molecular Properties
| Compound Name | 3-ethoxy-1-iodo-2,4-dimethoxybenzene |
| PubChem CID | 118835970 |
| Molecular Formula | C10H13IO3 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 3-ethoxy-1-iodo-2,4-dimethoxybenzene |
| SMILES | CCOc1c(OC)ccc(I)c1OC |
| InChI | InChI=1S/C10H13IO3/c1-4-14-10-8(12-2)6-5-7(11)9(10)13-3/h5-6H,4H2,1-3H3 |
| InChIKey | YBCCKJXTAFQYEY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-1-iodo-2,4-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-1-iodo-2,4-dimethoxybenzene?
The IUPAC name of 3-ethoxy-1-iodo-2,4-dimethoxybenzene (CID 118835970) is 3-ethoxy-1-iodo-2,4-dimethoxybenzene.
What is the SMILES notation for 3-ethoxy-1-iodo-2,4-dimethoxybenzene?
The canonical SMILES for 3-ethoxy-1-iodo-2,4-dimethoxybenzene is CCOc1c(OC)ccc(I)c1OC.
What is the InChIKey of 3-ethoxy-1-iodo-2,4-dimethoxybenzene?
The InChIKey is YBCCKJXTAFQYEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13IO3/c1-4-14-10-8(12-2)6-5-7(11)9(10)13-3/h5-6H,4H2,1-3H3.
What are the key properties of 3-ethoxy-1-iodo-2,4-dimethoxybenzene?
3-ethoxy-1-iodo-2,4-dimethoxybenzene has a molecular weight of 308.12 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-1-iodo-2,4-dimethoxybenzene is sourced from PubChem (CID 118835970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).